EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | CCCCC/C=C/c1c(O)cc(CC=C(C)C)c2c1CC(O)O2 |
| InChI | InChI=1S/C20H28O3/c1-4-5-6-7-8-9-16-17-13-19(22)23-20(17)15(12-18(16)21)11-10-14(2)3/h8-10,12,19,21-22H,4-7,11,13H2,1-3H3/b9-8+ |
| InChIKey | GWSQXMVDKLYNRT-CMDGGOBGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eurotium repens (ncbitaxon:41409) | - | PubMed (21667972) | EtOAc extract of Lyophilized fungus which was homogenized with acetone |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-4-(hept-1-enyl)-7-(3-methylbut-2-enyl)-2,3-dihydrobenzofuran-2,5-diol (CHEBI:68187) has role metabolite (CHEBI:25212) |
| (E)-4-(hept-1-enyl)-7-(3-methylbut-2-enyl)-2,3-dihydrobenzofuran-2,5-diol (CHEBI:68187) is a benzofurans (CHEBI:35259) |
| Citations |
|---|