EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H47NO11 |
| Net Charge | 0 |
| Average Mass | 669.768 |
| Monoisotopic Mass | 669.31491 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)C(=C)[C@H](OC(=O)C(C)C)C[C@@H](OC(=O)c3cccnc3)C(C)(C)/C=C/[C@@H](C)C(=O)[C@@]1(OC(C)=O)C[C@H](C)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C36H47NO11/c1-19(2)33(42)46-27-16-28(47-34(43)26-12-11-15-37-18-26)35(9,10)14-13-20(3)32(41)36(48-25(8)40)17-21(4)30(44-23(6)38)29(36)31(22(27)5)45-24(7)39/h11-15,18-21,27-31H,5,16-17H2,1-4,6-10H3/b14-13+/t20-,21+,27-,28-,29-,30+,31+,36-/m1/s1 |
| InChIKey | XYOKQSPGNNDHGL-SDIFRHJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia esula (ncbitaxon:3993) | whole plant (BTO:0001461) | PubMed (21612217) | MeOH extract of whole fresh plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Esulatin M, (rel)- (CHEBI:68182) has role metabolite (CHEBI:25212) |
| Esulatin M, (rel)- (CHEBI:68182) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| rel-3beta,5alpha,15beta-triacetoxy-7beta-isobutanoyloxy-9alpha-nicotinoyloxyjatropha-6(17),11-dien-14-one | ChEBI |
| Citations |
|---|