EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H49NO13 |
| Net Charge | 0 |
| Average Mass | 727.804 |
| Monoisotopic Mass | 727.32039 |
| SMILES | [H][C@]12[C@@H](OC(C)=O)[C@](C)(OC(C)=O)C[C@]1(OC(C)=O)C(=O)[C@H](C)/C=C/C(C)(C)[C@H](OC(=O)c1cccnc1)C[C@@H](OC(=O)C(C)C)C(=C)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C38H49NO13/c1-20(2)34(45)49-28-17-29(50-35(46)27-13-12-16-39-18-27)36(9,10)15-14-21(3)32(44)38(52-26(8)43)19-37(11,51-25(7)42)33(48-24(6)41)30(38)31(22(28)4)47-23(5)40/h12-16,18,20-21,28-31,33H,4,17,19H2,1-3,5-11H3/b15-14+/t21-,28-,29-,30+,31+,33-,37-,38-/m1/s1 |
| InChIKey | NWWAFYRYZZFJCW-YWRBSOBWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia esula (ncbitaxon:3993) | whole plant (BTO:0001461) | PubMed (21612217) | MeOH extract of whole fresh plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Esulatin L, (rel)- (CHEBI:68181) has role metabolite (CHEBI:25212) |
| Esulatin L, (rel)- (CHEBI:68181) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| rel-2alpha,-3beta,5alpha,15beta-tetraacetoxy-7beta-isobutanoyloxy-9alpha-nicotinoyloxyjatropha-6(17),11E-dien-14-one | ChEBI |
| Citations |
|---|