EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O10 |
| Net Charge | 0 |
| Average Mass | 562.656 |
| Monoisotopic Mass | 562.27780 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)C(=C)[C@H](OC(=O)C(C)C)CC(=O)C(C)(C)/C=C/[C@@H](C)C(=O)[C@@]1(OC(C)=O)C[C@H](C)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C30H42O10/c1-15(2)28(36)39-22-13-23(34)29(9,10)12-11-16(3)27(35)30(40-21(8)33)14-17(4)25(37-19(6)31)24(30)26(18(22)5)38-20(7)32/h11-12,15-17,22,24-26H,5,13-14H2,1-4,6-10H3/b12-11+/t16-,17+,22-,24-,25+,26+,30-/m1/s1 |
| InChIKey | IXZMURMNDWWXES-DVTNSPDTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia esula (ncbitaxon:3993) | whole plant (BTO:0001461) | PubMed (21612217) | MeOH extract of whole fresh plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Esulatin J, (rel)- (CHEBI:68179) has role metabolite (CHEBI:25212) |
| Esulatin J, (rel)- (CHEBI:68179) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| rel-3beta,5alpha,15beta-triacetoxy-7beta-isobutanoyloxyjatropha-6(17),11Ediene-9,14-dione | ChEBI |
| Citations |
|---|