EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H54O18 |
| Net Charge | 0 |
| Average Mass | 798.832 |
| Monoisotopic Mass | 798.33101 |
| SMILES | [H][C@]12[C@@H](OC(C)=O)[C@](C)(OC(C)=O)C[C@]1(OC(C)=O)[C@]1(O)O[C@]([H])([C@@H](OC(C)=O)[C@H]1C)C(C)(C)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(=O)C(C)C)C(=C)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C38H54O18/c1-16(2)34(46)53-28-17(3)27(48-19(5)39)26-31(51-22(8)42)36(14,54-24(10)44)15-37(26,55-25(11)45)38(47)18(4)29(49-20(6)40)33(56-38)35(12,13)32(52-23(9)43)30(28)50-21(7)41/h16,18,26-33,47H,3,15H2,1-2,4-14H3/t18-,26+,27+,28+,29+,30-,31-,32-,33-,36-,37-,38-/m1/s1 |
| InChIKey | VJVKGUBLNAFZOG-DMNSQRRYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia esula (ncbitaxon:3993) | whole plant (BTO:0001461) | PubMed (21612217) | MeOH extract of whole fresh plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Esulatin H, (rel)- (CHEBI:68177) has role metabolite (CHEBI:25212) |
| Esulatin H, (rel)- (CHEBI:68177) is a oxolanes (CHEBI:26912) |
| Synonym | Source |
|---|---|
| rel-2alpha,3beta,5alpha,8alpha,9alpha,12alpha,15beta-heptaacetoxy-11,14-epoxy-14alpha-hydroxy-7beta-isobutanoyloxyjatropha-6(17)-ene | ChEBI |
| Citations |
|---|