EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O4 |
| Net Charge | 0 |
| Average Mass | 344.451 |
| Monoisotopic Mass | 344.19876 |
| SMILES | COc1cc(C[C@H](C)[C@H](C)Cc2ccc(OC)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H28O4/c1-14(10-16-6-8-18(22)20(12-16)24-4)15(2)11-17-7-9-19(23-3)21(13-17)25-5/h6-9,12-15,22H,10-11H2,1-5H3/t14-,15+/m0/s1 |
| InChIKey | NNYAKQAKXHZMKI-LSDHHAIUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus robusta (ncbitaxon:460780) | bark (BTO:0001301) | PubMed (21627109) | 95%aqueous EtOH extract of air-dried bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-(8R,8'S)-3,3',4-trimethoxy-4'-hydroxylignan (CHEBI:68170) has role plant metabolite (CHEBI:76924) |
| (−)-(8R,8'S)-3,3',4-trimethoxy-4'-hydroxylignan (CHEBI:68170) is a guaiacols (CHEBI:134251) |
| (−)-(8R,8'S)-3,3',4-trimethoxy-4'-hydroxylignan (CHEBI:68170) is a lignan (CHEBI:25036) |
| IUPAC Name |
|---|
| 4-[(2S,3R)-4-(3,4-dimethoxyphenyl)-2,3-dimethylbutyl]-2-methoxyphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7384710 | Reaxys |
| Citations |
|---|