EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O4 |
| Net Charge | 0 |
| Average Mass | 330.424 |
| Monoisotopic Mass | 330.18311 |
| SMILES | COc1cc(C[C@@H](C)[C@@H](C)Cc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C20H26O4/c1-13(9-15-5-7-17(21)19(11-15)23-3)14(2)10-16-6-8-18(22)20(12-16)24-4/h5-8,11-14,21-22H,9-10H2,1-4H3/t13-,14+ |
| InChIKey | ADFOLUXMYYCTRR-OKILXGFUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus robusta (ncbitaxon:460780) | bark (BTO:0001301) | PubMed (21627109) | 95%aqueous EtOH extract of air-dried bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meso-dihydroguaiaretic acid (CHEBI:68169) has role plant metabolite (CHEBI:76924) |
| meso-dihydroguaiaretic acid (CHEBI:68169) is a guaiacols (CHEBI:134251) |
| meso-dihydroguaiaretic acid (CHEBI:68169) is a lignan (CHEBI:25036) |
| IUPAC Name |
|---|
| 4,4'-[(2R,3S)-2,3-dimethylbutane-1,4-diyl]bis(2-methoxyphenol) |
| Synonyms | Source |
|---|---|
| 4,4'-dihydroxy-3,3'-dimethoxylignan | ChEBI |
| dihydroguaiaretic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3157473 | Reaxys |
| Citations |
|---|