EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O3 |
| Net Charge | 0 |
| Average Mass | 300.398 |
| Monoisotopic Mass | 300.17254 |
| SMILES | COc1cc(C[C@H](C)[C@H](C)Cc2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C19H24O3/c1-13(10-15-4-7-17(20)8-5-15)14(2)11-16-6-9-18(21)19(12-16)22-3/h4-9,12-14,20-21H,10-11H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | JXMPPMXQQGPEPV-KGLIPLIRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus robusta (ncbitaxon:460780) | bark (BTO:0001301) | PubMed (21627109) | 95%aqueous EtOH extract of air-dried bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(8S,8'R)-4,4'-dihydroxy-3-methoxylignan (CHEBI:68165) has role plant metabolite (CHEBI:76924) |
| (+)-(8S,8'R)-4,4'-dihydroxy-3-methoxylignan (CHEBI:68165) is a guaiacols (CHEBI:134251) |
| (+)-(8S,8'R)-4,4'-dihydroxy-3-methoxylignan (CHEBI:68165) is a lignan (CHEBI:25036) |
| IUPAC Name |
|---|
| 4-[(2S,3R)-4-(4-hydroxyphenyl)-2,3-dimethylbutyl]-2-methoxyphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646970 | Reaxys |
| Citations |
|---|