EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30O7 |
| Net Charge | 0 |
| Average Mass | 418.486 |
| Monoisotopic Mass | 418.19915 |
| SMILES | COc1cc(C[C@H](C)[C@H](COC(C)=O)Cc2cc(OC)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C23H30O7/c1-14(8-16-6-7-19(25)20(10-16)27-3)18(13-30-15(2)24)9-17-11-21(28-4)23(26)22(12-17)29-5/h6-7,10-12,14,18,25-26H,8-9,13H2,1-5H3/t14-,18-/m0/s1 |
| InChIKey | UBVTXRWIGGYYPO-KSSFIOAISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus robusta (ncbitaxon:460780) | bark (BTO:0001301) | PubMed (21627109) | 95%aqueous EtOH extract of air-dried bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(8S,8'R)-9'-acetoxy-4,4'-dihydroxy-3,3',5'-trimethoxylignan (CHEBI:68164) has role plant metabolite (CHEBI:76924) |
| (+)-(8S,8'R)-9'-acetoxy-4,4'-dihydroxy-3,3',5'-trimethoxylignan (CHEBI:68164) is a acetate ester (CHEBI:47622) |
| (+)-(8S,8'R)-9'-acetoxy-4,4'-dihydroxy-3,3',5'-trimethoxylignan (CHEBI:68164) is a dimethoxybenzene (CHEBI:51681) |
| (+)-(8S,8'R)-9'-acetoxy-4,4'-dihydroxy-3,3',5'-trimethoxylignan (CHEBI:68164) is a lignan (CHEBI:25036) |
| (+)-(8S,8'R)-9'-acetoxy-4,4'-dihydroxy-3,3',5'-trimethoxylignan (CHEBI:68164) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2R,3S)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-4-(4-hydroxy-3-methoxyphenyl)-3-methylbutyl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646980 | Reaxys |
| Citations |
|---|