EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O5 |
| Net Charge | 0 |
| Average Mass | 374.477 |
| Monoisotopic Mass | 374.20932 |
| SMILES | COc1cc(C[C@H](C)[C@H](C)Cc2cc(OC)c(OC)c(OC)c2)ccc1O |
| InChI | InChI=1S/C22H30O5/c1-14(9-16-7-8-18(23)19(11-16)24-3)15(2)10-17-12-20(25-4)22(27-6)21(13-17)26-5/h7-8,11-15,23H,9-10H2,1-6H3/t14-,15+/m0/s1 |
| InChIKey | HDQFIVFINXJTNV-LSDHHAIUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus robusta (ncbitaxon:460780) | bark (BTO:0001301) | PubMed (21627109) | 95% aqueous EtOH extract of air-dried bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(8S,8'R)-4-hydroxy-3,3',4',5'-tetramethoxylignan (CHEBI:68162) has role plant metabolite (CHEBI:76924) |
| (+)-(8S,8'R)-4-hydroxy-3,3',4',5'-tetramethoxylignan (CHEBI:68162) is a lignan (CHEBI:25036) |
| (+)-(8S,8'R)-4-hydroxy-3,3',4',5'-tetramethoxylignan (CHEBI:68162) is a methoxybenzenes (CHEBI:51683) |
| (+)-(8S,8'R)-4-hydroxy-3,3',4',5'-tetramethoxylignan (CHEBI:68162) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-[(2S,3R)-2,3-dimethyl-4-(3,4,5-trimethoxyphenyl)butyl]-2-methoxyphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646971 | Reaxys |
| Citations |
|---|