EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O5 |
| Net Charge | 0 |
| Average Mass | 360.450 |
| Monoisotopic Mass | 360.19367 |
| SMILES | COc1cc(C[C@H](C)[C@H](C)Cc2cc(OC)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H28O5/c1-13(8-15-6-7-17(22)18(10-15)24-3)14(2)9-16-11-19(25-4)21(23)20(12-16)26-5/h6-7,10-14,22-23H,8-9H2,1-5H3/t13-,14+/m0/s1 |
| InChIKey | GFMUBOWRQZASFJ-UONOGXRCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus robusta (ncbitaxon:460780) | bark (BTO:0001301) | PubMed (21627109) | 95% aqueous EtOH extract of air-dried bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(8S,8'R)-4,4'-dihydroxy-3,3',5'-trimethoxylignan (CHEBI:68161) has role plant metabolite (CHEBI:76924) |
| (+)-(8S,8'R)-4,4'-dihydroxy-3,3',5'-trimethoxylignan (CHEBI:68161) is a dimethoxybenzene (CHEBI:51681) |
| (+)-(8S,8'R)-4,4'-dihydroxy-3,3',5'-trimethoxylignan (CHEBI:68161) is a lignan (CHEBI:25036) |
| (+)-(8S,8'R)-4,4'-dihydroxy-3,3',5'-trimethoxylignan (CHEBI:68161) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-[(2R,3S)-4-(4-hydroxy-3-methoxyphenyl)-2,3-dimethylbutyl]-2,6-dimethoxyphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646973 | Reaxys |
| Citations |
|---|