EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O5 |
| Net Charge | 0 |
| Average Mass | 346.423 |
| Monoisotopic Mass | 346.17802 |
| SMILES | COc1cc(C[C@H](C)[C@H](C)Cc2cc(O)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C20H26O5/c1-12(7-14-5-6-16(21)18(10-14)24-3)13(2)8-15-9-17(22)20(23)19(11-15)25-4/h5-6,9-13,21-23H,7-8H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | QGQBCKHIRCELEH-QWHCGFSZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus robusta (ncbitaxon:460780) | bark (BTO:0001301) | PubMed (21627109) | 95% aqueous EtOH extract of air-dried bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(8S,8'R)-3',4,4'-trihydroxy-5,5'-dimethoxylignan (CHEBI:68160) has role plant metabolite (CHEBI:76924) |
| (+)-(8S,8'R)-3',4,4'-trihydroxy-5,5'-dimethoxylignan (CHEBI:68160) is a catechols (CHEBI:33566) |
| (+)-(8S,8'R)-3',4,4'-trihydroxy-5,5'-dimethoxylignan (CHEBI:68160) is a guaiacols (CHEBI:134251) |
| (+)-(8S,8'R)-3',4,4'-trihydroxy-5,5'-dimethoxylignan (CHEBI:68160) is a lignan (CHEBI:25036) |
| IUPAC Name |
|---|
| 5-[(2R,3S)-4-(4-hydroxy-3-methoxyphenyl)-2,3-dimethylbutyl]-3-methoxybenzene-1,2-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646974 | Reaxys |
| Citations |
|---|