EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O5 |
| Net Charge | 0 |
| Average Mass | 358.434 |
| Monoisotopic Mass | 358.17802 |
| SMILES | COc1cc2c(cc1O)[C@H](c1cc(OC)c(O)c(OC)c1)[C@@H](C)[C@@H](C)C2 |
| InChI | InChI=1S/C21H26O5/c1-11-6-13-7-17(24-3)16(22)10-15(13)20(12(11)2)14-8-18(25-4)21(23)19(9-14)26-5/h7-12,20,22-23H,6H2,1-5H3/t11-,12-,20-/m0/s1 |
| InChIKey | QHLOLFAIJRCECK-PVUDRZGPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus robusta (ncbitaxon:460780) | bark (BTO:0001301) | PubMed (21627109) | 95% aqueous EtOH extract of air-dried bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-(+)-(7'S,8S,8'S)-4,4'-dihydroxy-3',5,5'-trimethoxy-2,7'-cyclolignan (CHEBI:68159) has role plant metabolite (CHEBI:76924) |
| rel-(+)-(7'S,8S,8'S)-4,4'-dihydroxy-3',5,5'-trimethoxy-2,7'-cyclolignan (CHEBI:68159) is a dimethoxybenzene (CHEBI:51681) |
| rel-(+)-(7'S,8S,8'S)-4,4'-dihydroxy-3',5,5'-trimethoxy-2,7'-cyclolignan (CHEBI:68159) is a lignan (CHEBI:25036) |
| rel-(+)-(7'S,8S,8'S)-4,4'-dihydroxy-3',5,5'-trimethoxy-2,7'-cyclolignan (CHEBI:68159) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| rel-(6S,7S,8S)-8-(4-hydroxy-3,5-dimethoxyphenyl)-3-methoxy-6,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646977 | Reaxys |
| Citations |
|---|