EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11ClFN5O3 |
| Net Charge | 0 |
| Average Mass | 303.681 |
| Monoisotopic Mass | 303.05345 |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1F |
| InChI | InChI=1S/C10H11ClFN5O3/c11-10-15-7(13)5-8(16-10)17(2-14-5)9-4(12)6(19)3(1-18)20-9/h2-4,6,9,18-19H,1H2,(H2,13,15,16)/t3-,4+,6-,9-/m1/s1 |
| InChIKey | WDDPHFBMKLOVOX-AYQXTPAHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clofarabine (CHEBI:681569) has role antimetabolite (CHEBI:35221) |
| clofarabine (CHEBI:681569) has role antineoplastic agent (CHEBI:35610) |
| clofarabine (CHEBI:681569) is a adenosines (CHEBI:22260) |
| clofarabine (CHEBI:681569) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 2-chloro-9-(2-deoxy-2-fluoro-β-D-arabinofuranosyl)-9H-purin-6-amine |
| INNs | Source |
|---|---|
| clofarabine | KEGG DRUG |
| clofarabina | ChEBI |
| clofarabinum | ChEBI |
| Synonyms | Source |
|---|---|
| clofarabine | ChEMBL |
| 2-chloro-9-(2-deoxy-2-fluoro-β-D-arabinofuranosyl)adenine | ChemIDplus |
| CAFdA | ChEBI |
| 2-chloro-9-(2'-deoxy-2'-fluoro-β-D-arabinofuranosyl)adenine | ChEBI |
| (2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol | DrugBank |
| Cl-F-Ara-A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D03546 | KEGG DRUG |
| DB00631 | DrugBank |
| Clofarabine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4882539 | Beilstein |
| CAS:123318-82-1 | KEGG DRUG |
| CAS:123318-82-1 | ChemIDplus |
| Citations |
|---|