EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O3 |
| Net Charge | 0 |
| Average Mass | 220.268 |
| Monoisotopic Mass | 220.10994 |
| SMILES | COc1cc2c(cc1O)C(=O)[C@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C13H16O3/c1-7-4-9-5-12(16-3)11(14)6-10(9)13(15)8(7)2/h5-8,14H,4H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | QRXKBYPNTKDXIG-HTQZYQBOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus robusta (ncbitaxon:460780) | bark (BTO:0001301) | PubMed (21627109) | 95% aqueous EtOH extract of air-dried bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(8R,8'R)-4-hydroxy-5-methoxy-1',2',3',4',5',6'-hexanor-2,7'-cyclolignan-7'-one (CHEBI:68156) has role plant metabolite (CHEBI:76924) |
| (+)-(8R,8'R)-4-hydroxy-5-methoxy-1',2',3',4',5',6'-hexanor-2,7'-cyclolignan-7'-one (CHEBI:68156) is a lignan (CHEBI:25036) |
| (+)-(8R,8'R)-4-hydroxy-5-methoxy-1',2',3',4',5',6'-hexanor-2,7'-cyclolignan-7'-one (CHEBI:68156) is a monomethoxybenzene (CHEBI:25235) |
| (+)-(8R,8'R)-4-hydroxy-5-methoxy-1',2',3',4',5',6'-hexanor-2,7'-cyclolignan-7'-one (CHEBI:68156) is a phenols (CHEBI:33853) |
| (+)-(8R,8'R)-4-hydroxy-5-methoxy-1',2',3',4',5',6'-hexanor-2,7'-cyclolignan-7'-one (CHEBI:68156) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| (2R,3R)-7-hydroxy-6-methoxy-2,3-dimethyl-3,4-dihydronaphthalen-1(2H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646969 | Reaxys |
| Citations |
|---|