EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O |
| Net Charge | 0 |
| Average Mass | 220.356 |
| Monoisotopic Mass | 220.18272 |
| SMILES | C=C1CC/C=C(\C)CC[C@@H](C(C)C)C(=O)C1 |
| InChI | InChI=1S/C15H24O/c1-11(2)14-9-8-12(3)6-5-7-13(4)10-15(14)16/h6,11,14H,4-5,7-10H2,1-3H3/b12-6+/t14-/m0/s1 |
| InChIKey | QTFJNWQFKJITEE-CYIWUNGXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acorus calamus (ncbitaxon:4465) | rhizome (BTO:0001181) | PubMed (21563811) | Dried and cut rhizomes(ground roots) extracted by maceration with petroleum ether |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-Preisocalamenediol (CHEBI:68149) has role metabolite (CHEBI:25212) |
| (+)-Preisocalamenediol (CHEBI:68149) is a germacrane sesquiterpenoid (CHEBI:68588) |
| Synonym | Source |
|---|---|
| (2S,5E)-2-Isopropyl-5-methyl-9-methylene-5-cyclodecen-1-one | ChEBI |
| Citations |
|---|