EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | C[C@@H]1CCC2=C1C=C1C(C)(C)OO[C@@]1(O)C[C@H]2C |
| InChI | InChI=1S/C15H22O3/c1-9-5-6-11-10(2)8-15(16)13(7-12(9)11)14(3,4)17-18-15/h7,9-10,16H,5-6,8H2,1-4H3/t9-,10-,15+/m1/s1 |
| InChIKey | WXNXTCLYINNSQL-FCHSOHFDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarcophyton glaucum (ncbitaxon:70919) | - | PubMed (21563811) | |
| Acorus calamus (ncbitaxon:4465) | rhizome (BTO:0001181) | PubMed (21563811) | Dried and cut rhizomes(ground roots) extracted by maceration with petroleum ether |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-Dioxosarcoguaiacol, (rel)- (CHEBI:68147) has role metabolite (CHEBI:25212) |
| (+)-Dioxosarcoguaiacol, (rel)- (CHEBI:68147) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| rel-(5R,8R,9aS)-3,3,5,8-Tetramethyl-3,5,6,7,8,9-hexahydro-9aH-azuleno[6,5-c][1,2]dioxol-9a-ol | ChEBI |
| Citations |
|---|