EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H30O14 |
| Net Charge | 0 |
| Average Mass | 638.578 |
| Monoisotopic Mass | 638.16356 |
| SMILES | COc1c(O)cc([C@H]2Oc3cc(O)cc(O)c3[C@@H](c3c(O)cc(O)c4c3O[C@H](c3cc(O)c(OC)c(O)c3)[C@@H](O)C4)[C@@H]2O)cc1O |
| InChI | InChI=1S/C32H30O14/c1-43-31-18(37)3-11(4-19(31)38)28-22(41)9-14-15(34)10-17(36)25(30(14)46-28)26-24-16(35)7-13(33)8-23(24)45-29(27(26)42)12-5-20(39)32(44-2)21(40)6-12/h3-8,10,22,26-29,33-42H,9H2,1-2H3/t22-,26-,27-,28+,29+/m0/s1 |
| InChIKey | ISROEXZIVCZASE-AVFWISQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parapiptadenia rigida (ncbitaxon:148713) | bark (BTO:0001301) | PubMed (21553897) | EtOH extract of air-dried and powdered bark, compound is a mixture of two stable rotamers |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4α→8)-bis-4'-O-methylgallocatechin (CHEBI:68145) is a biflavonoid (CHEBI:50128) |
| (4α→8)-bis-4'-O-methylgallocatechin (CHEBI:68145) is a hydroxyflavan (CHEBI:72010) |
| (4α→8)-bis-4'-O-methylgallocatechin (CHEBI:68145) is a methoxyflavan (CHEBI:72585) |
| (4α→8)-bis-4'-O-methylgallocatechin (CHEBI:68145) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (2R,2'R,3S,3'S,4S)-2,2'-bis(3,5-dihydroxy-4-methoxyphenyl)-3,3',4,4'-tetrahydro-2H,2'H-4,8'-bichromene-3,3',5,5',7,7'-hexol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8381156 | Reaxys |
| Citations |
|---|