EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H28O13 |
| Net Charge | 0 |
| Average Mass | 608.552 |
| Monoisotopic Mass | 608.15299 |
| SMILES | COc1c(O)cc([C@H]2Oc3c(c(O)cc(O)c3[C@H]3c4c(O)cc(O)cc4O[C@H](c4ccc(O)c(O)c4)[C@@H]3O)C[C@@H]2O)cc1O |
| InChI | InChI=1S/C31H28O13/c1-42-31-20(38)5-12(6-21(31)39)28-22(40)9-14-16(34)10-19(37)25(30(14)44-28)26-24-18(36)7-13(32)8-23(24)43-29(27(26)41)11-2-3-15(33)17(35)4-11/h2-8,10,22,26-29,32-41H,9H2,1H3/t22-,26+,27+,28+,29+/m0/s1 |
| InChIKey | ADKHKBZKHGJXDZ-UKWJTHFESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parapiptadenia rigida (ncbitaxon:148713) | bark (BTO:0001301) | PubMed (21553897) | EtOH extract of air-dried and powdered bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epicatechin-(4beta->8)-4'-O-methylgallocatechin (CHEBI:68144) has role metabolite (CHEBI:25212) |
| epicatechin-(4beta->8)-4'-O-methylgallocatechin (CHEBI:68144) is a proanthocyanidin (CHEBI:26267) |
| Synonym | Source |
|---|---|
| (2R,2'R,3R,3'S,4R)-2'-(3,5-Dihydroxy-4-methoxyphenyl)-2-(3,4-dihydroxyphenyl)-3,3',4,4'-tetrahydro-2H,2'H-4,8'-bichromene-3,3',5,5',7,7'-hexol | ChEBI |
| Citations |
|---|