EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H30O18 |
| Net Charge | 0 |
| Average Mass | 762.629 |
| Monoisotopic Mass | 762.14321 |
| SMILES | O=C(O[C@@H]1Cc2c(O)cc(O)c([C@H]3c4c(O)cc(O)cc4O[C@H](c4cc(O)c(O)c(O)c4)[C@@H]3O)c2O[C@@H]1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C37H30O18/c38-14-7-17(40)27-25(8-14)53-35(12-3-21(44)31(49)22(45)4-12)33(51)29(27)28-18(41)10-16(39)15-9-26(54-37(52)13-5-23(46)32(50)24(47)6-13)34(55-36(15)28)11-1-19(42)30(48)20(43)2-11/h1-8,10,26,29,33-35,38-51H,9H2/t26-,29-,33-,34-,35-/m1/s1 |
| InChIKey | JSBXKZFDEDBAQA-WUFIRYPCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morella rubra (ncbitaxon:262757) | bark (BTO:0001301) | PubMed (21553897) | |
| Parapiptadenia rigida (ncbitaxon:148713) | bark (BTO:0001301) | PubMed (21553897) | EtOH extract of air-dried and powdered bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epigallocatechin-(4beta->8)-epigallocatechin-3-O-gallate (CHEBI:68142) has role metabolite (CHEBI:25212) |
| epigallocatechin-(4beta->8)-epigallocatechin-3-O-gallate (CHEBI:68142) is a proanthocyanidin (CHEBI:26267) |
| Synonym | Source |
|---|---|
| 3,4,5-Trihydroxy-benzoic acid (2R,3R,4R,2'R,3'R)-3,5,7,5',7'-pentahydroxy-2,2'-bis-(3,4,5-trihydroxy-phenyl)-3,4,3',4'-tetrahydro-2H,2'H-[4,8']bichromenyl-3'-yl ester | ChEBI |
| Citations |
|---|