EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O4 |
| Net Charge | 0 |
| Average Mass | 270.284 |
| Monoisotopic Mass | 270.08921 |
| SMILES | COc1cccc2c1C(=O)OC(c1ccc(O)cc1)C2 |
| InChI | InChI=1S/C16H14O4/c1-19-13-4-2-3-11-9-14(20-16(18)15(11)13)10-5-7-12(17)8-6-10/h2-8,14,17H,9H2,1H3 |
| InChIKey | NDEGOVKGGPNZCS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | Dried powdered roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scorzotomentosin, (rac)- (CHEBI:68141) has role metabolite (CHEBI:25212) |
| scorzotomentosin, (rac)- (CHEBI:68141) is a 2-benzopyran (CHEBI:38444) |
| Citations |
|---|