EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O7 |
| Net Charge | 0 |
| Average Mass | 374.389 |
| Monoisotopic Mass | 374.13655 |
| SMILES | [H][C@]12[C@H](O)O[C@H](c3ccc(O)c(OC)c3)[C@]1([H])CO[C@H]2c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C20H22O7/c1-24-15-7-10(3-5-13(15)21)18-12-9-26-19(17(12)20(23)27-18)11-4-6-14(22)16(8-11)25-2/h3-8,12,17-23H,9H2,1-2H3/t12-,17+,18-,19+,20-/m1/s1 |
| InChIKey | REZVXIYYURPOSL-ARALLLCVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | Dried powdered roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4α-hydroxypinoresinol (CHEBI:68137) has functional parent pinoresinol (CHEBI:8225) |
| 4α-hydroxypinoresinol (CHEBI:68137) has role plant metabolite (CHEBI:76924) |
| 4α-hydroxypinoresinol (CHEBI:68137) is a furofuran (CHEBI:47790) |
| 4α-hydroxypinoresinol (CHEBI:68137) is a guaiacols (CHEBI:134251) |
| 4α-hydroxypinoresinol (CHEBI:68137) is a lignan (CHEBI:25036) |
| IUPAC Name |
|---|
| (1R,3S,3aS,6R,6aS)-3,6-bis(4-hydroxy-3-methoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6576206 | Reaxys |
| Citations |
|---|