EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | [H][C@]1([C@H](O)c2ccc(O)cc2)OC(=O)c2c(O)cccc21 |
| InChI | InChI=1S/C15H12O5/c16-9-6-4-8(5-7-9)13(18)14-10-2-1-3-11(17)12(10)15(19)20-14/h1-7,13-14,16-18H/t13-,14+/m1/s1 |
| InChIKey | FADYYEHFGLVECU-KGLIPLIRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | Dried powdered roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydramacrophyllol B (CHEBI:68135) has role plant metabolite (CHEBI:76924) |
| hydramacrophyllol B (CHEBI:68135) is a isobenzofuranone (CHEBI:55372) |
| hydramacrophyllol B (CHEBI:68135) is a phenols (CHEBI:33853) |
| hydramacrophyllol B (CHEBI:68135) is a secondary alcohol (CHEBI:35681) |
| hydramacrophyllol B (CHEBI:68135) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3S)-7-hydroxy-3-[(R)-hydroxy(4-hydroxyphenyl)methyl]-2-benzofuran-1(3H)-one |
| Synonym | Source |
|---|---|
| (3S)-7-hydroxy-3-((R)-hydroxy(4-hydroxyphenyl)methyl)-isobenzofuran-1(3H)-one | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6959572 | Reaxys |
| CAS:157598-01-1 | ChemIDplus |
| Citations |
|---|