EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32O12 |
| Net Charge | 0 |
| Average Mass | 536.530 |
| Monoisotopic Mass | 536.18938 |
| SMILES | [H][C@@]1(O[C@H]2O[C@H](c3ccc(O)c(OC)c3)[C@@]3([H])CO[C@@H](c4ccc(O)c(OC)c4)[C@@]23[H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H32O12/c1-33-16-7-11(3-5-14(16)28)23-13-10-35-24(12-4-6-15(29)17(8-12)34-2)19(13)25(37-23)38-26-22(32)21(31)20(30)18(9-27)36-26/h3-8,13,18-32H,9-10H2,1-2H3/t13-,18+,19-,20+,21-,22+,23+,24-,25+,26-/m0/s1 |
| InChIKey | AUBYZINWDYPNHW-WGUDKIRSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | Dried powdered roots |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4β-[(β-D-glucopyranosyl)hydroxy]-pinoresinol (CHEBI:68132) has functional parent pinoresinol (CHEBI:8225) |
| 4β-[(β-D-glucopyranosyl)hydroxy]-pinoresinol (CHEBI:68132) has role metabolite (CHEBI:25212) |
| 4β-[(β-D-glucopyranosyl)hydroxy]-pinoresinol (CHEBI:68132) has role plant metabolite (CHEBI:76924) |
| 4β-[(β-D-glucopyranosyl)hydroxy]-pinoresinol (CHEBI:68132) is a furofuran (CHEBI:47790) |
| 4β-[(β-D-glucopyranosyl)hydroxy]-pinoresinol (CHEBI:68132) is a guaiacols (CHEBI:134251) |
| 4β-[(β-D-glucopyranosyl)hydroxy]-pinoresinol (CHEBI:68132) is a lignan (CHEBI:25036) |
| 4β-[(β-D-glucopyranosyl)hydroxy]-pinoresinol (CHEBI:68132) is a monosaccharide derivative (CHEBI:63367) |
| 4β-[(β-D-glucopyranosyl)hydroxy]-pinoresinol (CHEBI:68132) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (1R,3S,3aR,6R,6aS)-3,6-bis(4-hydroxy-3-methoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23435551 | Reaxys |
| Citations |
|---|