EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12O6 |
| Net Charge | 0 |
| Average Mass | 312.277 |
| Monoisotopic Mass | 312.06339 |
| SMILES | O=C1OC(c2ccc(O)c(O)c2)=C/C1=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H12O6/c18-12-3-1-9(6-14(12)20)5-11-8-16(23-17(11)22)10-2-4-13(19)15(21)7-10/h1-8,18-21H/b11-5- |
| InChIKey | TZBZGNPXKXHFKI-WZUFQYTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | 1. Dried powdered roots2. The E derivative, isolated from the mycelia of Rhizoctonia strain F23372 |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-3-(3,4-dihydroxybenzylidene)-5-(3,4-dihydroxyphenyl)-2(3H)-furanone (CHEBI:68131) has role plant metabolite (CHEBI:76924) |
| (Z)-3-(3,4-dihydroxybenzylidene)-5-(3,4-dihydroxyphenyl)-2(3H)-furanone (CHEBI:68131) is a butenolide (CHEBI:50523) |
| (Z)-3-(3,4-dihydroxybenzylidene)-5-(3,4-dihydroxyphenyl)-2(3H)-furanone (CHEBI:68131) is a catechols (CHEBI:33566) |
| IUPAC Name |
|---|
| (3Z)-3-(3,4-dihydroxybenzylidene)-5-(3,4-dihydroxyphenyl)furan-2(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646959 | Reaxys |
| Citations |
|---|