EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | O=C(Cc1cccc(O)c1C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H12O5/c16-11-6-4-9(5-7-11)13(18)8-10-2-1-3-12(17)14(10)15(19)20/h1-7,16-17H,8H2,(H,19,20) |
| InChIKey | YIGHIFUVVSYMFG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | Dried powdered roots |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-6-[2-(4-hydroxyphenyl)-2-oxo-ethyl]benzoic acid (CHEBI:68126) has role metabolite (CHEBI:25212) |
| 2-hydroxy-6-[2-(4-hydroxyphenyl)-2-oxo-ethyl]benzoic acid (CHEBI:68126) has role plant metabolite (CHEBI:76924) |
| 2-hydroxy-6-[2-(4-hydroxyphenyl)-2-oxo-ethyl]benzoic acid (CHEBI:68126) is a aromatic ketone (CHEBI:76224) |
| 2-hydroxy-6-[2-(4-hydroxyphenyl)-2-oxo-ethyl]benzoic acid (CHEBI:68126) is a monohydroxybenzoic acid (CHEBI:25389) |
| 2-hydroxy-6-[2-(4-hydroxyphenyl)-2-oxo-ethyl]benzoic acid (CHEBI:68126) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-hydroxy-6-[2-(4-hydroxyphenyl)-2-oxoethyl]benzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646956 | Reaxys |
| Citations |
|---|