EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24N2O3 |
| Net Charge | 0 |
| Average Mass | 316.401 |
| Monoisotopic Mass | 316.17869 |
| SMILES | CCC(C)C(=O)NC1CCC(=O)N(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C18H24N2O3/c1-3-13(2)17(22)19-15-9-10-16(21)20(18(15)23)12-11-14-7-5-4-6-8-14/h4-8,13,15H,3,9-12H2,1-2H3,(H,19,22) |
| InChIKey | ASALPLLZVFIFMF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton pullei var. glabrior (IPNI:343310-1) | - | PubMed (21545108) | |
| Julocroton montevidensis (IPNI:350558-1) | - | PubMed (21545108) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Julocrotine (CHEBI:68121) has role metabolite (CHEBI:25212) |
| Julocrotine (CHEBI:68121) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| N-[2,6-Dioxo-1-(2-phenylethyl)-3-piperidinyl]-2-methylbutanamide | ChEBI |
| Citations |
|---|