EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O6 |
| Net Charge | 0 |
| Average Mass | 394.508 |
| Monoisotopic Mass | 394.23554 |
| SMILES | [H][C@@]12O[C@]1([C@@H](O)/C=C(\C)C[C@@H](O)/C=C(\C)CCC=C(C)C)[C@@H](O)C=C(CO)[C@H]2O |
| InChI | InChI=1S/C22H34O6/c1-13(2)6-5-7-14(3)8-17(24)9-15(4)10-18(25)22-19(26)11-16(12-23)20(27)21(22)28-22/h6,8,10-11,17-21,23-27H,5,7,9,12H2,1-4H3/b14-8+,15-10+/t17-,18-,19-,20+,21-,22+/m0/s1 |
| InChIKey | GIACKNPQRFVICY-XMCVGHNMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthrobotrys oligospora (ncbitaxon:13349) | - | PubMed (21568306) | Ethyl acetate extract of culture broth filtrate of Strain YMF 1.3170 isolated from a grapery Strain: YMF 1.3170 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arthrobotrisin A (CHEBI:68118) has role metabolite (CHEBI:25212) |
| arthrobotrisin A (CHEBI:68118) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| (1'R,2'S,5'R,6'S)-1-((1'S,2'E,5'R,6'E)-1,5-dihydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl)-4-(hydroxymethyl)-7-oxa-bicyclo[4.1.0]hept-3-ene-2,5-diol | ChEBI |
| Citations |
|---|