EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39N5O11S |
| Net Charge | 0 |
| Average Mass | 641.700 |
| Monoisotopic Mass | 641.23668 |
| SMILES | [H][C@]1([C@H](C)O)NC(=O)[C@@H](NC(=O)[C@@H](CS(=O)(=O)O)NC(=O)[C@@H](NC(=O)Cc2ccccc2)C(C)C)[C@@H](C)OC(=O)CCNC1=O |
| InChI | InChI=1S/C27H39N5O11S/c1-14(2)21(30-19(34)12-17-8-6-5-7-9-17)26(38)29-18(13-44(40,41)42)24(36)32-23-16(4)43-20(35)10-11-28-25(37)22(15(3)33)31-27(23)39/h5-9,14-16,18,21-23,33H,10-13H2,1-4H3,(H,28,37)(H,29,38)(H,30,34)(H,31,39)(H,32,36)(H,40,41,42)/t15-,16+,18+,21-,22+,23-/m0/s1 |
| InChIKey | IGQWJTOITVEYBJ-GMYCQRIPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species RI051-SDHV6 (ncbitaxon:867680) | mycelium (BTO:0001436) | PubMed (21491925) | The mycelial cake was extracted with 80% aqueous acetone |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JBIR-96 (CHEBI:68117) is a peptide (CHEBI:16670) |
| Citations |
|---|