EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O3 |
| Net Charge | 0 |
| Average Mass | 342.479 |
| Monoisotopic Mass | 342.21949 |
| SMILES | C=C1CCCC(C)(C)C1CCC1(C)C=Cc2cc(O)cc(OC)c2O1 |
| InChI | InChI=1S/C22H30O3/c1-15-7-6-10-21(2,3)18(15)9-12-22(4)11-8-16-13-17(23)14-19(24-5)20(16)25-22/h8,11,13-14,18,23H,1,6-7,9-10,12H2,2-5H3 |
| InChIKey | OKZZLCIFQGFNCQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Thorecta reticulata (ncbitaxon:1162800) | - | PubMed (21513294) | Methanolic extract of freeze dried animal material |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Metachromin U (CHEBI:68113) has role metabolite (CHEBI:25212) |
| Metachromin U (CHEBI:68113) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| 2-[2-(2,2-Dimethyl-6-methylenecyclohexyl)ethyl]-8-methoxy-2-methyl-2H-chromen-6-ol | ChEBI |
| Citations |
|---|