EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13N3O2 |
| Net Charge | 0 |
| Average Mass | 279.299 |
| Monoisotopic Mass | 279.10078 |
| SMILES | [H][C@@]1(c2ccc(O)cc2)N=CN2c3ccccc3C(=O)N[C@]21[H] |
| InChI | InChI=1S/C16H13N3O2/c20-11-7-5-10(6-8-11)14-15-18-16(21)12-3-1-2-4-13(12)19(15)9-17-14/h1-9,14-15,20H,(H,18,21)/t14-,15+/m0/s1 |
| InChIKey | SCCCIBBXTCKOTC-LSDHHAIUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium paneum (ncbitaxon:68879) | - | PubMed (21495659) | Ethylacetate extract of fermented rice substrate Strain: SD 44 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penipanoid B (CHEBI:68110) has role Penicillium metabolite (CHEBI:76964) |
| penipanoid B (CHEBI:68110) is a alkaloid (CHEBI:22315) |
| penipanoid B (CHEBI:68110) is a organic heterotricyclic compound (CHEBI:26979) |
| penipanoid B (CHEBI:68110) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| rel-(3S,3aR)-3-(4-hydroxyphenyl)-3a,4-dihydroimidazo[1,5-a]quinazolin-5(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21548731 | Reaxys |
| Citations |
|---|