EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O4 |
| Net Charge | 0 |
| Average Mass | 328.408 |
| Monoisotopic Mass | 328.16746 |
| SMILES | CC(C)=CCOc1cc(C)c2c(OCC=C(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H24O4/c1-13(2)6-8-22-16-10-15(5)20-17(23-9-7-14(3)4)12-19(21)24-18(20)11-16/h6-7,10-12H,8-9H2,1-5H3 |
| InChIKey | YYRFSVLPVFHWOJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mariannaea camptospora (ncbitaxon:233850) | - | PubMed (21488655) | The strain was isolated from a rotten wood sample Strain: TAMA 118 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Marianin A (CHEBI:68107) has role metabolite (CHEBI:25212) |
| Marianin A (CHEBI:68107) is a coumarins (CHEBI:23403) |
| Synonym | Source |
|---|---|
| 5-Methyl-4,7-bis[(3-methyl-2-buten-1-yl)oxy]-2H-chromen-2-one | ChEBI |
| Citations |
|---|