EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34ClNO3 |
| Net Charge | 0 |
| Average Mass | 407.982 |
| Monoisotopic Mass | 407.22272 |
| SMILES | [H][C@]12C/C=C(\C)C(=O)OCC/C(Cl)=C/[C@H](O)/C=C/[C@H](C)[C@@]3([H])CCC[C@@]3(CCC1)N2 |
| InChI | InChI=1S/C23H34ClNO3/c1-16-8-10-20(26)15-18(24)11-14-28-22(27)17(2)7-9-19-5-3-12-23(25-19)13-4-6-21(16)23/h7-8,10,15-16,19-21,25-26H,3-6,9,11-14H2,1-2H3/b10-8+,17-7+,18-15-/t16-,19+,20+,21+,23+/m0/s1 |
| InChIKey | YETAKRZPZUKKMS-IBSBDYNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Halichondria okadai (ncbitaxon:163232) | - | PubMed (21410164) | Methanolic extract of the crushed black sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pinnarine (CHEBI:68106) has role metabolite (CHEBI:25212) |
| Pinnarine (CHEBI:68106) is a macrolide (CHEBI:25106) |
| Synonym | Source |
|---|---|
| 1S,5R,6S,9R,10Z,16E,19R)-11-Chloro-9-hydroxy-6,16-dimethyl-14-oxa-23-azatricyclo[17.3.1.0(1,5)]tricosa-7,10,16-trien-15-one | ChEBI |
| Citations |
|---|