EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O |
| Net Charge | 0 |
| Average Mass | 412.702 |
| Monoisotopic Mass | 412.37052 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC[C@@H](CC)C(C)C |
| InChI | InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h18-21,24-27H,7-17H2,1-6H3/t20-,21-,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | RUVUHIUYGJBLGI-XJZKHKOHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Radermachera boniana (IPNI:110489-1) | |||
| twig (BTO:0001411) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves | |
| leaf (BTO:0000713) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beta-sitostenone (CHEBI:68105) has parent hydride stigmastane (CHEBI:26773) |
| beta-sitostenone (CHEBI:68105) has role metabolite (CHEBI:25212) |
| beta-sitostenone (CHEBI:68105) is a C29-steroid (CHEBI:188923) |
| beta-sitostenone (CHEBI:68105) is a steroid (CHEBI:35341) |
| Synonym | Source |
|---|---|
| Stigmast-4-en-3-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 0001058613 | ChemIDplus |
| Citations |
|---|