EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H50O4 |
| Net Charge | 0 |
| Average Mass | 498.748 |
| Monoisotopic Mass | 498.37091 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@@H](OC(C)=O)[C@]1(C)C(=O)O |
| InChI | InChI=1S/C32H50O4/c1-20(33)36-25-12-13-29(5)23-10-9-21-22-19-27(2,3)15-16-28(22,4)17-18-30(21,6)31(23,7)14-11-24(29)32(25,8)26(34)35/h9,22-25H,10-19H2,1-8H3,(H,34,35)/t22-,23+,24+,25+,28+,29+,30+,31+,32+/m0/s1 |
| InChIKey | IAWGZKRQDHPFCZ-OBHGTAHRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Radermachera boniana (IPNI:110489-1) | |||
| leaf (BTO:0000713) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves | |
| twig (BTO:0001411) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-alpha-O-acetyl-alpha-boswellic acid (CHEBI:68104) has role metabolite (CHEBI:25212) |
| 3-alpha-O-acetyl-alpha-boswellic acid (CHEBI:68104) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| (3alpha)-3-Acetoxyolean-12-en-24-oic acid | ChEBI |
| Citations |
|---|