EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O3 |
| Net Charge | 0 |
| Average Mass | 456.711 |
| Monoisotopic Mass | 456.36035 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8,20-23,31H,9-18H2,1-7H3,(H,32,33)/t20-,21-,22+,23+,27-,28+,29+,30-/m0/s1 |
| InChIKey | MIJYXULNPSFWEK-KDQGZELNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Radermachera boniana (IPNI:110489-1) | |||
| leaf (BTO:0000713) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves | |
| twig (BTO:0001411) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-epioleanolic acid (CHEBI:68103) has role metabolite (CHEBI:25212) |
| 3-epioleanolic acid (CHEBI:68103) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| (3alpha)-3-hydroxyolean-12-en-28-oic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036962 | HMDB |
| Citations |
|---|