EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H50O6 |
| Net Charge | 0 |
| Average Mass | 530.746 |
| Monoisotopic Mass | 530.36074 |
| SMILES | [H][C@]12CC=C3[C@@]4([H])[C@](C(=O)O)(CC[C@@H](C)[C@@]4(C)O)CC[C@@]3(C)[C@]1(C)C[C@@H](O)[C@@]1([H])C(C)(C)[C@@H](OC(C)=O)CC[C@]21C |
| InChI | InChI=1S/C32H50O6/c1-18-11-14-32(26(35)36)16-15-29(6)20(24(32)31(18,8)37)9-10-22-28(5)13-12-23(38-19(2)33)27(3,4)25(28)21(34)17-30(22,29)7/h9,18,21-25,34,37H,10-17H2,1-8H3,(H,35,36)/t18-,21-,22-,23+,24-,25+,28-,29-,30-,31-,32+/m1/s1 |
| InChIKey | KBYMABZAFBTCMQ-IQJXLAGFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Radermachera boniana (IPNI:110489-1) | |||
| twig (BTO:0001411) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves | |
| leaf (BTO:0000713) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-acetyluncaric acid (CHEBI:68102) has role metabolite (CHEBI:25212) |
| 3-O-acetyluncaric acid (CHEBI:68102) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| 3beta-O-acetyl-6beta,19alpha-diol-12-ursen-28-oic acid | ChEBI |
| Citations |
|---|