EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H50O5 |
| Net Charge | 0 |
| Average Mass | 514.747 |
| Monoisotopic Mass | 514.36582 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@@]4(CC[C@H](OC(C)=O)[C@@]3(C)C(=O)O)C[C@@]14CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CCC(=O)C(C)C |
| InChI | InChI=1S/C32H50O5/c1-19(2)23(34)9-8-20(3)22-12-14-29(6)24-10-11-25-30(7,27(35)36)26(37-21(4)33)13-15-31(25)18-32(24,31)17-16-28(22,29)5/h19-20,22,24-26H,8-18H2,1-7H3,(H,35,36)/t20-,22-,24+,25+,26+,28-,29+,30+,31-,32+/m1/s1 |
| InChIKey | ZVKOTDKTSIZJGD-RCYNUSLWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Radermachera boniana (IPNI:110489-1) | |||
| twig (BTO:0001411) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves | |
| leaf (BTO:0000713) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bonianic acid B, (rel)- (CHEBI:68101) has role metabolite (CHEBI:25212) |
| bonianic acid B, (rel)- (CHEBI:68101) is a triterpenoid (CHEBI:36615) |
| Synonyms | Source |
|---|---|
| rel-(3beta,9beta)-3-Acetoxy-24-oxo-9,19-cyclolanostan-28-oic acid | ChEBI |
| rel-3beta-O-acetylcycloart-24-one-28-oic acid | ChEBI |
| Citations |
|---|