EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H38O8 |
| Net Charge | 0 |
| Average Mass | 550.648 |
| Monoisotopic Mass | 550.25667 |
| SMILES | [H][C@]12CC[C@]3(C)C(=C1/C=C\[C@@H](OC(=O)/C(C)=C/C)[C@]1(C)CC(=O)[C@@]2(C)[C@H]1CC(=O)OC)CC(=O)O[C@H]3c1ccoc1 |
| InChI | InChI=1S/C32H38O8/c1-7-18(2)29(36)39-25-9-8-20-21(32(5)23(15-26(34)37-6)31(25,4)16-24(32)33)10-12-30(3)22(20)14-27(35)40-28(30)19-11-13-38-17-19/h7-9,11,13,17,21,23,25,28H,10,12,14-16H2,1-6H3/b9-8-,18-7+/t21-,23-,25+,28-,30+,31+,32+/m0/s1 |
| InChIKey | XVHXALVCAPLJJX-TXTGMHMPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chisocheton ceramicus (ncbitaxon:155624) | bark (BTO:0001301) | PubMed (21428417) | Methanolic extract of dried and powdered bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chisomicine A (CHEBI:68095) has role metabolite (CHEBI:25212) |
| Chisomicine A (CHEBI:68095) is a carbonyl compound (CHEBI:36586) |
| Synonym | Source |
|---|---|
| (1R,2S,5R,6R,12Z,14R,15R,18S)-6-(3-Furyl)-18-(2-methoxy-2-oxoethyl)-1,5,15-trimethyl-8,17-dioxo-7-oxatetracyclo[13.2.1.0(5,10)]octadeca-10,12-dien-14-yl (2E)-2-methyl-2-butenoate | ChEBI |
| Citations |
|---|