EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22N2O4 |
| Net Charge | 0 |
| Average Mass | 366.417 |
| Monoisotopic Mass | 366.15796 |
| SMILES | [H][C@]12C[C@]34C=CCN3CC[C@@]3(OC1=O)c1ccccc1N(C(=O)OC)[C@]23CC4 |
| InChI | InChI=1S/C21H22N2O4/c1-26-18(25)23-16-6-3-2-5-14(16)21-10-12-22-11-4-7-19(22)8-9-20(21,23)15(13-19)17(24)27-21/h2-7,15H,8-13H2,1H3/t15-,19+,20+,21+/m0/s1 |
| InChIKey | GLOIILVAVSJIEX-LWILDLIXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kopsia grandifolia (IPNI:60436655-2) | leaf (BTO:0000713) | PubMed (21428274) | leaf extract |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lapidilectine B (CHEBI:68093) has role metabolite (CHEBI:25212) |
| lapidilectine B (CHEBI:68093) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonym | Source |
|---|---|
| Methyl (1R,9R,12R,21R)-20-oxo-19-oxa-8,16-diazahexacyclo[10.6.4.0[1,9].0[2,7].0[9,21].0[12,16]]docosa-2,4,6,13-tetraene-8-carboxylate | ChEBI |
| Citations |
|---|