EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28N2O6 |
| Net Charge | 0 |
| Average Mass | 440.496 |
| Monoisotopic Mass | 440.19474 |
| SMILES | COC(=O)[C@@H]1C[C@]23C=CCN2CC[C@]2(C(=O)OC)c4ccccc4N(C(=O)OC)[C@]12CC3 |
| InChI | InChI=1S/C24H28N2O6/c1-30-19(27)17-15-22-9-6-13-25(22)14-12-23(20(28)31-2)16-7-4-5-8-18(16)26(21(29)32-3)24(17,23)11-10-22/h4-9,17H,10-15H2,1-3H3/t17-,22+,23+,24+/m0/s1 |
| InChIKey | YLBUDFTWGUSIKB-QKBJRNKPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kopsia grandifolia (IPNI:60436655-2) | stem (BTO:0001300) | PubMed (21428274) | Previous component: stem bark; stembark extract |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lapidilectine A, (rel)- (CHEBI:68090) has role metabolite (CHEBI:25212) |
| lapidilectine A, (rel)- (CHEBI:68090) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonym | Source |
|---|---|
| rel-Trimethyl (1R,9S,16R,18R)-2,12-diazapentacyclo[14.2.2.0[1,9].0[3,8].0[12,16]]icosa-3,5,7,14-tetraene-2,9,18-tricarboxylate | ChEBI |
| Citations |
|---|