EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O3 |
| Net Charge | 0 |
| Average Mass | 320.473 |
| Monoisotopic Mass | 320.23514 |
| SMILES | [H][C@@]12CC=C3C[C@@](C)(CCO)CC[C@]3([H])[C@@]1(C)CCC[C@]2(C)C(=O)O |
| InChI | InChI=1S/C20H32O3/c1-18(11-12-21)10-7-15-14(13-18)5-6-16-19(15,2)8-4-9-20(16,3)17(22)23/h5,15-16,21H,4,6-13H2,1-3H3,(H,22,23)/t15-,16+,18+,19+,20-/m0/s1 |
| InChIKey | FQUSLEQFAZWKIA-MSJBJCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | PubMed (21428374) | Endolichenic fungi isolated from Leptogium saturninum and EtOAc extract of fermented rice substrate |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-hydroxyisopimar-7-en-19-oic acid (CHEBI:68086) has parent hydride isopimarane (CHEBI:77046) |
| 16-hydroxyisopimar-7-en-19-oic acid (CHEBI:68086) has role fungal metabolite (CHEBI:76946) |
| 16-hydroxyisopimar-7-en-19-oic acid (CHEBI:68086) is a diterpenoid (CHEBI:23849) |
| 16-hydroxyisopimar-7-en-19-oic acid (CHEBI:68086) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| (13α)-16-hydroxypimar-7-en-19-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20232458 | Reaxys |
| Citations |
|---|