EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O3 |
| Net Charge | 0 |
| Average Mass | 430.673 |
| Monoisotopic Mass | 430.34470 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CC[C@@]1([H])C2=C[C@@H](O)[C@@]2(O)C[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C28H46O3/c1-17(2)18(3)7-8-19(4)22-9-10-23-21-15-25(30)28(31)16-20(29)11-14-27(28,6)24(21)12-13-26(22,23)5/h7-8,15,17-20,22-25,29-31H,9-14,16H2,1-6H3/b8-7+/t18-,19+,20-,22+,23-,24-,25+,26+,27+,28-/m0/s1 |
| InChIKey | ARXHRTZAVQOQEU-BRVLHLJYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | PubMed (21428374) | Endolichenic fungi isolated from Leptogium saturninum and EtOAc extract of fermented rice substrate |
| Aspergillus ochraceus (ncbitaxon:40380) | mycelium (BTO:0001436) | PubMed (21043476) | MeOH(mycelia) & EtOAc(broth) extract of an endophytic fungus isolated from Sargassum kjellmanianum Strain: EN 31 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cerevisterol (CHEBI:68083) has role Aspergillus metabolite (CHEBI:76956) |
| cerevisterol (CHEBI:68083) is a 3β-hydroxy steroid (CHEBI:36836) |
| cerevisterol (CHEBI:68083) is a 5α-hydroxy steroid (CHEBI:38194) |
| cerevisterol (CHEBI:68083) is a 6β-hydroxy steroid (CHEBI:36851) |
| cerevisterol (CHEBI:68083) is a ergostanoid (CHEBI:50403) |
| Incoming Relation(s) |
| (22E,24R)-ergosta-7,22-diene-6β-methoxy-3β,5α-diol (CHEBI:70337) has functional parent cerevisterol (CHEBI:68083) |
| IUPAC Name |
|---|
| (22E)-ergosta-7,22-diene-3β,5α,6β-triol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3224240 | Reaxys |
| CAS:516-37-0 | ChemIDplus |
| Citations |
|---|