EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O3 |
| Net Charge | 0 |
| Average Mass | 444.700 |
| Monoisotopic Mass | 444.36035 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CC[C@@]1([H])C2=C[C@@H](OC)[C@@]2(O)C[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C29H48O3/c1-18(2)19(3)8-9-20(4)23-10-11-24-22-16-26(32-7)29(31)17-21(30)12-15-28(29,6)25(22)13-14-27(23,24)5/h8-9,16,18-21,23-26,30-31H,10-15,17H2,1-7H3/b9-8+/t19-,20+,21-,23+,24-,25-,26+,27+,28+,29-/m0/s1 |
| InChIKey | GQVCGTRDXSDAHC-KNXFMRPFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | PubMed (21428374) | Endolichenic fungi isolated from Leptogium saturninum and EtOAc extract of fermented rice substrate |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| blazein (CHEBI:68081) has role fungal metabolite (CHEBI:76946) |
| blazein (CHEBI:68081) is a 3β-hydroxy steroid (CHEBI:36836) |
| blazein (CHEBI:68081) is a 5α-hydroxy steroid (CHEBI:38194) |
| blazein (CHEBI:68081) is a ergostanoid (CHEBI:50403) |
| blazein (CHEBI:68081) is a ether (CHEBI:25698) |
| IUPAC Name |
|---|
| (22E)-6β-methoxyergosta-7,22-diene-3β,5α-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3656902 | Reaxys |
| CAS:126060-09-1 | ChEBI |
| Citations |
|---|