EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H49N5O5 |
| Net Charge | 0 |
| Average Mass | 535.730 |
| Monoisotopic Mass | 535.37337 |
| SMILES | CC[C@@H](C)[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CC(C)C)NC1=O |
| InChI | InChI=1S/C28H49N5O5/c1-9-18(8)23-27(37)30-20(14-16(4)5)28(38)33-12-10-11-21(33)25(35)29-19(13-15(2)3)24(34)31-22(17(6)7)26(36)32-23/h15-23H,9-14H2,1-8H3,(H,29,35)(H,30,37)(H,31,34)(H,32,36)/t18-,19-,20+,21+,22+,23-/m1/s1 |
| InChIKey | XPNFTYQQDGDCDD-NURQPWONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | PubMed (21428374) | Endolichenic fungi isolated from Leptogium saturninum and EtOAc extract of fermented rice substrate |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (cyclo(L-Val-D-Ile-L-Leu-L-pro-D-Leu)) (CHEBI:68080) has role metabolite (CHEBI:25212) |
| (cyclo(L-Val-D-Ile-L-Leu-L-pro-D-Leu)) (CHEBI:68080) is a cyclic peptide (CHEBI:23449) |
| Citations |
|---|