EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H49N5O5 |
| Net Charge | 0 |
| Average Mass | 583.774 |
| Monoisotopic Mass | 583.37337 |
| SMILES | CC[C@@H](C)[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@@H]2CCCN2C(=O)[C@H](CC(C)C)NC1=O |
| InChI | InChI=1S/C32H49N5O5/c1-8-21(6)27-30(40)33-23(17-19(2)3)31(41)37-16-12-15-24(37)32(42)36(7)25(18-22-13-10-9-11-14-22)28(38)34-26(20(4)5)29(39)35-27/h9-11,13-14,19-21,23-27H,8,12,15-18H2,1-7H3,(H,33,40)(H,34,38)(H,35,39)/t21-,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | NSBVGLQWOAQURC-ZFWJRURNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | PubMed (21428374) | Endolichenic fungi isolated from Leptogium saturninum and EtOAc extract of fermented rice substrate |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (cyclo(N-methyl-L-Phe-L-Val-D-Ile-L-Leu-L-Pro)) (CHEBI:68079) has role metabolite (CHEBI:25212) |
| (cyclo(N-methyl-L-Phe-L-Val-D-Ile-L-Leu-L-Pro)) (CHEBI:68079) is a cyclic peptide (CHEBI:23449) |
| Synonym | Source |
|---|---|
| Cyclo(D-isoleucyl-L-leucyl-L-prolyl-N-methyl-L-phenylalanyl-L-valyl) | ChEBI |
| Citations |
|---|