EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O4 |
| Net Charge | 0 |
| Average Mass | 318.373 |
| Monoisotopic Mass | 318.15796 |
| SMILES | CC(C)=CCOc1ccc(CC2NC(=O)C(CO)NC2=O)cc1 |
| InChI | InChI=1S/C17H22N2O4/c1-11(2)7-8-23-13-5-3-12(4-6-13)9-14-16(21)19-15(10-20)17(22)18-14/h3-7,14-15,20H,8-10H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | KRLKPTMEUFJHKD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | mycelium (BTO:0001436) | PubMed (21381678) | Fungus isolated from the root surface of Rhizophora stylosa, EtOAc extract of fermentation broth Strain: PXP 55 |
| Roles Classification |
|---|
| Biological Role: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(hydroxymethyl)-6-[4-(3-methylbut-2-enyloxy)benzyl]piperazine-2,5-dione (CHEBI:68077) has role Penicillium metabolite (CHEBI:76964) |
| 3-(hydroxymethyl)-6-[4-(3-methylbut-2-enyloxy)benzyl]piperazine-2,5-dione (CHEBI:68077) is a aromatic ether (CHEBI:35618) |
| 3-(hydroxymethyl)-6-[4-(3-methylbut-2-enyloxy)benzyl]piperazine-2,5-dione (CHEBI:68077) is a cyclic ketone (CHEBI:3992) |
| 3-(hydroxymethyl)-6-[4-(3-methylbut-2-enyloxy)benzyl]piperazine-2,5-dione (CHEBI:68077) is a piperazinone (CHEBI:46846) |
| 3-(hydroxymethyl)-6-[4-(3-methylbut-2-enyloxy)benzyl]piperazine-2,5-dione (CHEBI:68077) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 3-(hydroxymethyl)-6-{4-[(3-methylbut-2-en-1-yl)oxy]benzyl}piperazine-2,5-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559824 | Reaxys |
| Citations |
|---|