EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5NO2 |
| Net Charge | 0 |
| Average Mass | 111.100 |
| Monoisotopic Mass | 111.03203 |
| SMILES | O=C(O)c1ccnc1 |
| InChI | InChI=1S/C5H5NO2/c7-5(8)4-1-2-6-3-4/h1-3,6H,(H,7,8) |
| InChIKey | DOYOPBSXEIZLRE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | mycelium (BTO:0001436) | PubMed (21381678) | Fungus isolated from the root surface of Rhizophora stylosa, EtOAc extract of fermentation broth Strain: PXP 55 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrrole-3-carboxylic acid (CHEBI:68076) has role Penicillium metabolite (CHEBI:76964) |
| pyrrole-3-carboxylic acid (CHEBI:68076) has role metabolite (CHEBI:25212) |
| pyrrole-3-carboxylic acid (CHEBI:68076) is a pyrrolecarboxylic acid (CHEBI:26454) |
| IUPAC Name |
|---|
| 1H-pyrrole-3-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:108642 | Reaxys |
| Citations |
|---|