EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO3 |
| Net Charge | 0 |
| Average Mass | 197.234 |
| Monoisotopic Mass | 197.10519 |
| SMILES | CCC[C@H](O)c1ccc(=O)nc1CO |
| InChI | InChI=1S/C10H15NO3/c1-2-3-9(13)7-4-5-10(14)11-8(7)6-12/h4-5,9,12-13H,2-3,6H2,1H3,(H,11,14)/t9-/m0/s1 |
| InChIKey | FNQPTDUMOGZQBY-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | mycelium (BTO:0001436) | PubMed (21381678) | Fungus isolated from the root surface of Rhizophora stylosa, EtOAc extract of fermentation broth Strain: PXP 55 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysogedone B (CHEBI:68075) has role Penicillium metabolite (CHEBI:76964) |
| chrysogedone B (CHEBI:68075) has role metabolite (CHEBI:25212) |
| chrysogedone B (CHEBI:68075) is a primary alcohol (CHEBI:15734) |
| chrysogedone B (CHEBI:68075) is a pyridone (CHEBI:38183) |
| chrysogedone B (CHEBI:68075) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 5-[(1S)-1-hydroxybutyl]-6-(hydroxymethyl)pyridin-2(1H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559823 | Reaxys |
| Citations |
|---|