EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO2 |
| Net Charge | 0 |
| Average Mass | 181.235 |
| Monoisotopic Mass | 181.11028 |
| SMILES | CCC[C@H](O)c1ccc(=O)nc1C |
| InChI | InChI=1S/C10H15NO2/c1-3-4-9(12)8-5-6-10(13)11-7(8)2/h5-6,9,12H,3-4H2,1-2H3,(H,11,13)/t9-/m0/s1 |
| InChIKey | KXOMTJKMEGIGSP-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | mycelium (BTO:0001436) | PubMed (21381678) | Fungus isolated from the root surface of Rhizophora stylosa, EtOAc extract of fermentation broth Strain: PXP 55 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysogedone A (CHEBI:68074) has role Penicillium metabolite (CHEBI:76964) |
| chrysogedone A (CHEBI:68074) has role metabolite (CHEBI:25212) |
| chrysogedone A (CHEBI:68074) is a pyridone (CHEBI:38183) |
| chrysogedone A (CHEBI:68074) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 5-[(1S)-1-hydroxybutyl]-6-methylpyridin-2(1H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559822 | Reaxys |
| Citations |
|---|